C11H12BrN — CID 130055868
4-(3-bromoprop-1-ynyl)-N,N-dimethylaniline (PubChem CID 130055868) has the molecular formula C11H12BrN and a molecular weight of 238.13 g/mol. Its IUPAC name is 4-(3-bromoprop-1-ynyl)-N,N-dimethylaniline.
| Compound Name | 4-(3-bromoprop-1-ynyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 130055868 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 4-(3-bromoprop-1-ynyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C#CCBr)cc1 |
| InChI | InChI=1S/C11H12BrN/c1-13(2)11-7-5-10(6-8-11)4-3-9-12/h5-8H,9H2,1-2H3 |
| InChIKey | UEYVFXFUOLEHGC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|