C10H10BrN — CID 86205951
4-(2-bromoethynyl)-N,N-dimethylaniline (PubChem CID 86205951) has the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. Its IUPAC name is 4-(2-bromoethynyl)-N,N-dimethylaniline.
| Compound Name | 4-(2-bromoethynyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 86205951 |
| Molecular Formula | C10H10BrN |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 4-(2-bromoethynyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C#CBr)cc1 |
| InChI | InChI=1S/C10H10BrN/c1-12(2)10-5-3-9(4-6-10)7-8-11/h3-6H,1-2H3 |
| InChIKey | DVDAEDHCEGDXPP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|