C24H16N2O2 — CID 101353728
4-[(E)-3,4-diethynyl-6-(4-nitrophenyl)hex-3-en-1,5-diynyl]-N,N-dimethylaniline (PubChem CID 101353728) has the molecular formula C24H16N2O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-[(E)-3,4-diethynyl-6-(4-nitrophenyl)hex-3-en-1,5-diynyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-3,4-diethynyl-6-(4-nitrophenyl)hex-3-en-1,5-diynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101353728 |
| Molecular Formula | C24H16N2O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-[(E)-3,4-diethynyl-6-(4-nitrophenyl)hex-3-en-1,5-diynyl]-N,N-dimethylaniline |
| SMILES | C#C/C(C#Cc1ccc(N(C)C)cc1)=C(/C#C)C#Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H16N2O2/c1-5-21(13-7-19-9-15-23(16-10-19)25(3)4)22(6-2)14-8-20-11-17-24(18-12-20)26(27)28/h1-2,9-12,15-18H,3-4H3/b22-21+ |
| InChIKey | WVKUNRVRBBZGEQ-QURGRASLSA-N |
| XLogP | 3.63 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|