C27H26N4O2 — CID 19421082
4-[6-[4-(dimethylamino)phenyl]-4-(4-nitrophenyl)-2-pyridinyl]-N,N-dimethylaniline (PubChem CID 19421082) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[6-[4-(dimethylamino)phenyl]-4-(4-nitrophenyl)-2-pyridinyl]-N,N-dimethylaniline.
| Compound Name | 4-[6-[4-(dimethylamino)phenyl]-4-(4-nitrophenyl)-2-pyridinyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 19421082 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 4-[6-[4-(dimethylamino)phenyl]-4-(4-nitrophenyl)-2-pyridinyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cc(-c3ccc([N+](=O)[O-])cc3)cc(-c3ccc(N(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H26N4O2/c1-29(2)23-11-7-20(8-12-23)26-17-22(19-5-15-25(16-6-19)31(32)33)18-27(28-26)21-9-13-24(14-10-21)30(3)4/h5-18H,1-4H3 |
| InChIKey | BHMRZCFYLPOBAR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|