C30H28N8O4 — CID 622677
4-[6-[4-(dimethylamino)phenyl]-1,4-bis(4-nitrophenyl)-1,2,4,5-tetrazin-3-yl]-N,N-dimethylaniline (PubChem CID 622677) has the molecular formula C30H28N8O4 and a molecular weight of 564.61 g/mol. Its IUPAC name is 4-[6-[4-(dimethylamino)phenyl]-1,4-bis(4-nitrophenyl)-1,2,4,5-tetrazin-3-yl]-N,N-dimethylaniline.
| Compound Name | 4-[6-[4-(dimethylamino)phenyl]-1,4-bis(4-nitrophenyl)-1,2,4,5-tetrazin-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 622677 |
| Molecular Formula | C30H28N8O4 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 4-[6-[4-(dimethylamino)phenyl]-1,4-bis(4-nitrophenyl)-1,2,4,5-tetrazin-3-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2=NN(c3ccc([N+](=O)[O-])cc3)C(c3ccc(N(C)C)cc3)=NN2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H28N8O4/c1-33(2)23-9-5-21(6-10-23)29-31-36(26-15-19-28(20-16-26)38(41)42)30(22-7-11-24(12-8-22)34(3)4)32-35(29)25-13-17-27(18-14-25)37(39)40/h5-20H,1-4H3 |
| InChIKey | WCJPUYKQPBBROM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 123.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|