C39H31F3N4O6S — CID 161048800
N,N-dimethyl-4-(4-nitrophenyl)aniline;4-(4-nitrophenyl)benzenethiol;1-(4-nitrophenyl)-4-(trifluoromethyl)benzene (PubChem CID 161048800) has the molecular formula C39H31F3N4O6S and a molecular weight of 740.76 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-nitrophenyl)aniline;4-(4-nitrophenyl)benzenethiol;1-(4-nitrophenyl)-4-(trifluoromethyl)benzene.
| Compound Name | N,N-dimethyl-4-(4-nitrophenyl)aniline;4-(4-nitrophenyl)benzenethiol;1-(4-nitrophenyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 161048800 |
| Molecular Formula | C39H31F3N4O6S |
| Molecular Weight | 740.76 g/mol |
| Exact Mass | 740.19 |
| IUPAC Name | N,N-dimethyl-4-(4-nitrophenyl)aniline;4-(4-nitrophenyl)benzenethiol;1-(4-nitrophenyl)-4-(trifluoromethyl)benzene |
| SMILES | CN(C)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1.O=[N+]([O-])c1ccc(-c2ccc(C(F)(F)F)cc2)cc1.O=[N+]([O-])c1ccc(-c2ccc(S)cc2)cc1 |
| InChI | InChI=1S/C14H14N2O2.C13H8F3NO2.C12H9NO2S/c1-15(2)13-7-3-11(4-8-13)12-5-9-14(10-6-12)16(17)18;14-13(15,16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)17(18)19;14-13(15)11-5-1-9(2-6-11)10-3-7-12(16)8-4-10/h3-10H,1-2H3;1-8H;1-8,16H |
| InChIKey | UBVWOYABWULMAL-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 132.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.76 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|