About CID 10622326
CID 10622326 (PubChem CID 10622326) has the molecular formula C24H22FeN2O2+2
and a molecular weight of 426.30 g/mol.
Molecular Properties
| Compound Name | CID 10622326 |
| PubChem CID | 10622326 |
| Molecular Formula | C24H22FeN2O2+2 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc([C]2[CH][CH][CH][C]2c2ccc([N+](=O)[O-])cc2)cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C19H17N2O2.C5H5.Fe/c1-20(2)16-10-6-14(7-11-16)18-4-3-5-19(18)15-8-12-17(13-9-15)21(22)23;1-2-4-5-3-1;/h3-13H,1-2H3;1-5H;/q;;+2 |
| InChIKey | MMZURBRDTGPQNI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 10622326 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10622326?
The IUPAC name of CID 10622326 (CID 10622326) is not available.
What is the SMILES notation for CID 10622326?
The canonical SMILES for CID 10622326 is CN(C)c1ccc([C]2[CH][CH][CH][C]2c2ccc([N+](=O)[O-])cc2)cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10622326?
The InChIKey is MMZURBRDTGPQNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N2O2.C5H5.Fe/c1-20(2)16-10-6-14(7-11-16)18-4-3-5-19(18)15-8-12-17(13-9-15)21(22)23;1-2-4-5-3-1;/h3-13H,1-2H3;1-5H;/q;;+2.
What are the key properties of CID 10622326?
CID 10622326 has a molecular weight of 426.30 g/mol, XLogP of 4.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10622326 is sourced from PubChem (CID 10622326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).