C13H12N2O2 — CID 11287619
N-methyl-4-nitro-N-phenylaniline (PubChem CID 11287619) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-methyl-4-nitro-N-phenylaniline.
| Compound Name | N-methyl-4-nitro-N-phenylaniline |
|---|---|
| PubChem CID | 11287619 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-methyl-4-nitro-N-phenylaniline |
| SMILES | CN(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H12N2O2/c1-14(11-5-3-2-4-6-11)12-7-9-13(10-8-12)15(16)17/h2-10H,1H3 |
| InChIKey | FVFQVUSECGNYPG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|