About (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one
(4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one (PubChem CID 2177190) has the molecular formula C23H17N3O4
and a molecular weight of 399.41 g/mol. Its IUPAC name is (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one |
| PubChem CID | 2177190 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one |
| SMILES | CN(c1ccccc1)c1ccc(/C=C2\C(=O)ON=C2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H17N3O4/c1-25(18-5-3-2-4-6-18)19-11-7-16(8-12-19)15-21-22(24-30-23(21)27)17-9-13-20(14-10-17)26(28)29/h2-15H,1H3/b21-15- |
| InChIKey | JZCQHMRLHIODDX-QNGOZBTKSA-N |
| XLogP | 4.71 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one?
The IUPAC name of (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one (CID 2177190) is (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one.
What is the SMILES notation for (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one?
The canonical SMILES for (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one is CN(c1ccccc1)c1ccc(/C=C2\C(=O)ON=C2c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one?
The InChIKey is JZCQHMRLHIODDX-QNGOZBTKSA-N. The full InChI is InChI=1S/C23H17N3O4/c1-25(18-5-3-2-4-6-18)19-11-7-16(8-12-19)15-21-22(24-30-23(21)27)17-9-13-20(14-10-17)26(28)29/h2-15H,1H3/b21-15-.
What are the key properties of (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one?
(4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one has a molecular weight of 399.41 g/mol, XLogP of 4.71, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[[4-(N-methylanilino)phenyl]methylidene]-3-(4-nitrophenyl)-1,2-oxazol-5-one is sourced from PubChem (CID 2177190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).