C28H19N3O5 — CID 139254268
(4Z)-4-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-5-one (PubChem CID 139254268) has the molecular formula C28H19N3O5 and a molecular weight of 477.48 g/mol. Its IUPAC name is (4Z)-4-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 139254268 |
| Molecular Formula | C28H19N3O5 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | (4Z)-4-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccc(-c3ccccn3)cc2)/C1=C/c1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H19N3O5/c32-28-25(27(30-36-28)22-10-8-21(9-11-22)26-3-1-2-16-29-26)17-19-6-14-24(15-7-19)35-18-20-4-12-23(13-5-20)31(33)34/h1-17H,18H2/b25-17- |
| InChIKey | ITKRXQTZTODFQT-UQQQWYQISA-N |
| XLogP | 5.58 |
| TPSA | 103.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|