C27H24N2O4 — CID 139254286
(4Z)-4-[[4-(oxan-2-ylmethoxy)phenyl]methylidene]-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-5-one (PubChem CID 139254286) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (4Z)-4-[[4-(oxan-2-ylmethoxy)phenyl]methylidene]-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-[[4-(oxan-2-ylmethoxy)phenyl]methylidene]-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 139254286 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (4Z)-4-[[4-(oxan-2-ylmethoxy)phenyl]methylidene]-3-(4-pyridin-2-ylphenyl)-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccc(-c3ccccn3)cc2)/C1=C/c1ccc(OCC2CCCCO2)cc1 |
| InChI | InChI=1S/C27H24N2O4/c30-27-24(17-19-7-13-22(14-8-19)32-18-23-5-2-4-16-31-23)26(29-33-27)21-11-9-20(10-12-21)25-6-1-3-15-28-25/h1,3,6-15,17,23H,2,4-5,16,18H2/b24-17- |
| InChIKey | JIOBPLQGXDOIQY-ULJHMMPZSA-N |
| XLogP | 5.04 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|