C15H18N2O3 — CID 95265259
5-methyl-3-[4-[[(2S)-oxan-2-yl]methoxy]phenyl]-1,2,4-oxadiazole (PubChem CID 95265259) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-methyl-3-[4-[[(2S)-oxan-2-yl]methoxy]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-methyl-3-[4-[[(2S)-oxan-2-yl]methoxy]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 95265259 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 5-methyl-3-[4-[[(2S)-oxan-2-yl]methoxy]phenyl]-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2ccc(OC[C@@H]3CCCCO3)cc2)no1 |
| InChI | InChI=1S/C15H18N2O3/c1-11-16-15(17-20-11)12-5-7-13(8-6-12)19-10-14-4-2-3-9-18-14/h5-8,14H,2-4,9-10H2,1H3/t14-/m0/s1 |
| InChIKey | OFNYTGFHYUQZDZ-AWEZNQCLSA-N |
| XLogP | 2.99 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |