C15H16N2O4 — CID 146098585
3-[4-(oxiran-2-ylmethoxy)phenyl]-5-(oxolan-2-yl)-1,2,4-oxadiazole (PubChem CID 146098585) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-[4-(oxiran-2-ylmethoxy)phenyl]-5-(oxolan-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-(oxiran-2-ylmethoxy)phenyl]-5-(oxolan-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 146098585 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-[4-(oxiran-2-ylmethoxy)phenyl]-5-(oxolan-2-yl)-1,2,4-oxadiazole |
| SMILES | c1cc(-c2noc(C3CCCO3)n2)ccc1OCC1CO1 |
| InChI | InChI=1S/C15H16N2O4/c1-2-13(18-7-1)15-16-14(17-21-15)10-3-5-11(6-4-10)19-8-12-9-20-12/h3-6,12-13H,1-2,7-9H2 |
| InChIKey | JQOURJUVKQYZQF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|