C12H11FN2O5S — CID 154879901
3-(4-fluorosulfonyloxyphenyl)-5-(oxolan-2-yl)-1,2,4-oxadiazole (PubChem CID 154879901) has the molecular formula C12H11FN2O5S and a molecular weight of 314.29 g/mol. Its IUPAC name is 3-(4-fluorosulfonyloxyphenyl)-5-(oxolan-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-fluorosulfonyloxyphenyl)-5-(oxolan-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 154879901 |
| Molecular Formula | C12H11FN2O5S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-(4-fluorosulfonyloxyphenyl)-5-(oxolan-2-yl)-1,2,4-oxadiazole |
| SMILES | O=S(=O)(F)Oc1ccc(-c2noc(C3CCCO3)n2)cc1 |
| InChI | InChI=1S/C12H11FN2O5S/c13-21(16,17)20-9-5-3-8(4-6-9)11-14-12(19-15-11)10-2-1-7-18-10/h3-6,10H,1-2,7H2 |
| InChIKey | YOMDFAIYXGMYTG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |