C14H14N2O4 — CID 129370564
methyl 4-[5-[(2R)-oxolan-2-yl]-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 129370564) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is methyl 4-[5-[(2R)-oxolan-2-yl]-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | methyl 4-[5-[(2R)-oxolan-2-yl]-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 129370564 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | methyl 4-[5-[(2R)-oxolan-2-yl]-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2noc([C@H]3CCCO3)n2)cc1 |
| InChI | InChI=1S/C14H14N2O4/c1-18-14(17)10-6-4-9(5-7-10)12-15-13(20-16-12)11-3-2-8-19-11/h4-7,11H,2-3,8H2,1H3/t11-/m1/s1 |
| InChIKey | IGTWVICSPYQLIT-LLVKDONJSA-N |
| XLogP | 2.37 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |