C13H16N2O2 — CID 168997991
3-(4-butoxyphenyl)-5-methyl-1,2,4-oxadiazole (PubChem CID 168997991) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-(4-butoxyphenyl)-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 168997991 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-(4-butoxyphenyl)-5-methyl-1,2,4-oxadiazole |
| SMILES | CCCCOc1ccc(-c2noc(C)n2)cc1 |
| InChI | InChI=1S/C13H16N2O2/c1-3-4-9-16-12-7-5-11(6-8-12)13-14-10(2)17-15-13/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | POSGNESXJCJPTK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|