C15H16N4O2 — CID 21193526
3-[4-[3-(1H-imidazol-5-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 21193526) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-[4-[3-(1H-imidazol-5-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[4-[3-(1H-imidazol-5-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 21193526 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[4-[3-(1H-imidazol-5-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2ccc(OCCCc3cnc[nH]3)cc2)no1 |
| InChI | InChI=1S/C15H16N4O2/c1-11-18-15(19-21-11)12-4-6-14(7-5-12)20-8-2-3-13-9-16-10-17-13/h4-7,9-10H,2-3,8H2,1H3,(H,16,17) |
| InChIKey | CLLATYZXQJSEKY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|