C18H17ClN2O3 — CID 166185984
3-[3-[3-(4-chlorophenoxy)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 166185984) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is 3-[3-[3-(4-chlorophenoxy)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[3-[3-(4-chlorophenoxy)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 166185984 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-[3-[3-(4-chlorophenoxy)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2cccc(OCCCOc3ccc(Cl)cc3)c2)no1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-13-20-18(21-24-13)14-4-2-5-17(12-14)23-11-3-10-22-16-8-6-15(19)7-9-16/h2,4-9,12H,3,10-11H2,1H3 |
| InChIKey | XURDYYHFLZLGNS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|