C28H38N2O2 — CID 3095312
3-(4-heptoxyphenyl)-5-(4-heptylphenyl)-1,2,4-oxadiazole (PubChem CID 3095312) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is 3-(4-heptoxyphenyl)-5-(4-heptylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-heptoxyphenyl)-5-(4-heptylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 3095312 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 3-(4-heptoxyphenyl)-5-(4-heptylphenyl)-1,2,4-oxadiazole |
| SMILES | CCCCCCCOc1ccc(-c2noc(-c3ccc(CCCCCCC)cc3)n2)cc1 |
| InChI | InChI=1S/C28H38N2O2/c1-3-5-7-9-11-13-23-14-16-25(17-15-23)28-29-27(30-32-28)24-18-20-26(21-19-24)31-22-12-10-8-6-4-2/h14-21H,3-13,22H2,1-2H3 |
| InChIKey | ZIYBYCXHOMGSPQ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|