C39H50N2O4 — CID 102137833
octyl 4-[5-[4-(4-decoxyphenyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 102137833) has the molecular formula C39H50N2O4 and a molecular weight of 610.84 g/mol. Its IUPAC name is octyl 4-[5-[4-(4-decoxyphenyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | octyl 4-[5-[4-(4-decoxyphenyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 102137833 |
| Molecular Formula | C39H50N2O4 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | octyl 4-[5-[4-(4-decoxyphenyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(-c3nc(-c4ccc(C(=O)OCCCCCCCC)cc4)no3)cc2)cc1 |
| InChI | InChI=1S/C39H50N2O4/c1-3-5-7-9-11-12-14-15-29-43-36-27-25-32(26-28-36)31-17-21-34(22-18-31)38-40-37(41-45-38)33-19-23-35(24-20-33)39(42)44-30-16-13-10-8-6-4-2/h17-28H,3-16,29-30H2,1-2H3 |
| InChIKey | YHHLKAXKXKTUPR-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|