C48H58N2O7 — CID 132607487
[4-[5-[4-(4-decoxybenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-decoxybenzoate (PubChem CID 132607487) has the molecular formula C48H58N2O7 and a molecular weight of 775.00 g/mol. Its IUPAC name is [4-[5-[4-(4-decoxybenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-decoxybenzoate.
| Compound Name | [4-[5-[4-(4-decoxybenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 132607487 |
| Molecular Formula | C48H58N2O7 |
| Molecular Weight | 775.00 g/mol |
| Exact Mass | 774.42 |
| IUPAC Name | [4-[5-[4-(4-decoxybenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3noc(-c4ccc(OC(=O)c5ccc(OCCCCCCCCCC)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C48H58N2O7/c1-3-5-7-9-11-13-15-17-35-53-41-27-23-39(24-28-41)47(51)55-43-31-19-37(20-32-43)45-49-46(57-50-45)38-21-33-44(34-22-38)56-48(52)40-25-29-42(30-26-40)54-36-18-16-14-12-10-8-6-4-2/h19-34H,3-18,35-36H2,1-2H3 |
| InChIKey | ZBQUBUBUUQEKDI-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 109.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.00 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|