C40H42N2O6 — CID 102124899
[4-[5-[4-(4-hexoxybenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-hexylbenzoate (PubChem CID 102124899) has the molecular formula C40H42N2O6 and a molecular weight of 646.78 g/mol. Its IUPAC name is [4-[5-[4-(4-hexoxybenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-hexylbenzoate.
| Compound Name | [4-[5-[4-(4-hexoxybenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-hexylbenzoate |
|---|---|
| PubChem CID | 102124899 |
| Molecular Formula | C40H42N2O6 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.30 |
| IUPAC Name | [4-[5-[4-(4-hexoxybenzoyl)oxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl] 4-hexylbenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(-c3nc(-c4ccc(OC(=O)c5ccc(CCCCCC)cc5)cc4)no3)cc2)cc1 |
| InChI | InChI=1S/C40H42N2O6/c1-3-5-7-9-11-29-12-14-32(15-13-29)39(43)46-35-24-16-30(17-25-35)37-41-38(48-42-37)31-18-26-36(27-19-31)47-40(44)33-20-22-34(23-21-33)45-28-10-8-6-4-2/h12-27H,3-11,28H2,1-2H3 |
| InChIKey | NTJWRXNDSQIJCC-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|