C44H50N2O7 — CID 102447911
[4-[5-[4-(4-octoxybenzoyl)oxyphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-octoxybenzoate (PubChem CID 102447911) has the molecular formula C44H50N2O7 and a molecular weight of 718.89 g/mol. Its IUPAC name is [4-[5-[4-(4-octoxybenzoyl)oxyphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-octoxybenzoate.
| Compound Name | [4-[5-[4-(4-octoxybenzoyl)oxyphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 102447911 |
| Molecular Formula | C44H50N2O7 |
| Molecular Weight | 718.89 g/mol |
| Exact Mass | 718.36 |
| IUPAC Name | [4-[5-[4-(4-octoxybenzoyl)oxyphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3nnc(-c4ccc(OC(=O)c5ccc(OCCCCCCCC)cc5)cc4)o3)cc2)cc1 |
| InChI | InChI=1S/C44H50N2O7/c1-3-5-7-9-11-13-31-49-37-23-19-35(20-24-37)43(47)51-39-27-15-33(16-28-39)41-45-46-42(53-41)34-17-29-40(30-18-34)52-44(48)36-21-25-38(26-22-36)50-32-14-12-10-8-6-4-2/h15-30H,3-14,31-32H2,1-2H3 |
| InChIKey | DFLAYXZQKKSFGG-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 109.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.89 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|