C42H54N4O4 — CID 3725956
2-(4-decoxyphenyl)-5-[4-[5-(4-decoxyphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-1,3,4-oxadiazole (PubChem CID 3725956) has the molecular formula C42H54N4O4 and a molecular weight of 678.92 g/mol. Its IUPAC name is 2-(4-decoxyphenyl)-5-[4-[5-(4-decoxyphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-decoxyphenyl)-5-[4-[5-(4-decoxyphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 3725956 |
| Molecular Formula | C42H54N4O4 |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.41 |
| IUPAC Name | 2-(4-decoxyphenyl)-5-[4-[5-(4-decoxyphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-1,3,4-oxadiazole |
| SMILES | CCCCCCCCCCOc1ccc(-c2nnc(-c3ccc(-c4nnc(-c5ccc(OCCCCCCCCCC)cc5)o4)cc3)o2)cc1 |
| InChI | InChI=1S/C42H54N4O4/c1-3-5-7-9-11-13-15-17-31-47-37-27-23-35(24-28-37)41-45-43-39(49-41)33-19-21-34(22-20-33)40-44-46-42(50-40)36-25-29-38(30-26-36)48-32-18-16-14-12-10-8-6-4-2/h19-30H,3-18,31-32H2,1-2H3 |
| InChIKey | MLXSKYPXYOJQAZ-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|