C21H22N6O2 — CID 50936800
2-(4-hexoxyphenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]-1,3,4-oxadiazole (PubChem CID 50936800) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-(4-hexoxyphenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-hexoxyphenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 50936800 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-(4-hexoxyphenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]-1,3,4-oxadiazole |
| SMILES | CCCCCCOc1ccc(-c2nnc(-c3ccc(-c4nn[nH]n4)cc3)o2)cc1 |
| InChI | InChI=1S/C21H22N6O2/c1-2-3-4-5-14-28-18-12-10-17(11-13-18)21-25-24-20(29-21)16-8-6-15(7-9-16)19-22-26-27-23-19/h6-13H,2-5,14H2,1H3,(H,22,23,26,27) |
| InChIKey | PVABISQHVRJUTQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 102.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|