C30H42N2O3 — CID 102447909
2,5-bis(4-octoxyphenyl)-1,3,4-oxadiazole (PubChem CID 102447909) has the molecular formula C30H42N2O3 and a molecular weight of 478.68 g/mol. Its IUPAC name is 2,5-bis(4-octoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2,5-bis(4-octoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 102447909 |
| Molecular Formula | C30H42N2O3 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | 2,5-bis(4-octoxyphenyl)-1,3,4-oxadiazole |
| SMILES | CCCCCCCCOc1ccc(-c2nnc(-c3ccc(OCCCCCCCC)cc3)o2)cc1 |
| InChI | InChI=1S/C30H42N2O3/c1-3-5-7-9-11-13-23-33-27-19-15-25(16-20-27)29-31-32-30(35-29)26-17-21-28(22-18-26)34-24-14-12-10-8-6-4-2/h15-22H,3-14,23-24H2,1-2H3 |
| InChIKey | MSYCHQWHJSUGCH-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|