C32H45NO4 — CID 19795413
octyl 2-(4-decoxyphenyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 19795413) has the molecular formula C32H45NO4 and a molecular weight of 507.72 g/mol. Its IUPAC name is octyl 2-(4-decoxyphenyl)-1,3-benzoxazole-5-carboxylate.
| Compound Name | octyl 2-(4-decoxyphenyl)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 19795413 |
| Molecular Formula | C32H45NO4 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | octyl 2-(4-decoxyphenyl)-1,3-benzoxazole-5-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(-c2nc3cc(C(=O)OCCCCCCCC)ccc3o2)cc1 |
| InChI | InChI=1S/C32H45NO4/c1-3-5-7-9-11-12-14-15-23-35-28-20-17-26(18-21-28)31-33-29-25-27(19-22-30(29)37-31)32(34)36-24-16-13-10-8-6-4-2/h17-22,25H,3-16,23-24H2,1-2H3 |
| InChIKey | LVMDOZQDBUURCL-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|