C28H30N2O3 — CID 3126596
4-heptoxy-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide (PubChem CID 3126596) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-heptoxy-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide.
| Compound Name | 4-heptoxy-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 3126596 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-heptoxy-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2cccc(-c3nc4cc(C)ccc4o3)c2)cc1 |
| InChI | InChI=1S/C28H30N2O3/c1-3-4-5-6-7-17-32-24-14-12-21(13-15-24)27(31)29-23-10-8-9-22(19-23)28-30-25-18-20(2)11-16-26(25)33-28/h8-16,18-19H,3-7,17H2,1-2H3,(H,29,31) |
| InChIKey | CJVIUIUGQWQOJJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|