C23H19ClN2O3 — CID 23937296
N-[2-(3-chlorophenyl)-1,3-benzoxazol-5-yl]-4-propoxybenzamide (PubChem CID 23937296) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-1,3-benzoxazol-5-yl]-4-propoxybenzamide.
| Compound Name | N-[2-(3-chlorophenyl)-1,3-benzoxazol-5-yl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 23937296 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[2-(3-chlorophenyl)-1,3-benzoxazol-5-yl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2ccc3oc(-c4cccc(Cl)c4)nc3c2)cc1 |
| InChI | InChI=1S/C23H19ClN2O3/c1-2-12-28-19-9-6-15(7-10-19)22(27)25-18-8-11-21-20(14-18)26-23(29-21)16-4-3-5-17(24)13-16/h3-11,13-14H,2,12H2,1H3,(H,25,27) |
| InChIKey | LAKISNJORUAUST-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |