C28H30N2O3 — CID 3877415
4-butoxy-N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 3877415) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-butoxy-N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 4-butoxy-N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 3877415 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-butoxy-N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc3oc(-c4ccc(C(C)(C)C)cc4)nc3c2)cc1 |
| InChI | InChI=1S/C28H30N2O3/c1-5-6-17-32-23-14-9-19(10-15-23)26(31)29-22-13-16-25-24(18-22)30-27(33-25)20-7-11-21(12-8-20)28(2,3)4/h7-16,18H,5-6,17H2,1-4H3,(H,29,31) |
| InChIKey | UKJUBZQCODYRBG-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|