C24H21FN2O2 — CID 23960249
4-tert-butyl-N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 23960249) has the molecular formula C24H21FN2O2 and a molecular weight of 388.44 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 23960249 |
| Molecular Formula | C24H21FN2O2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-tert-butyl-N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc3oc(-c4cccc(F)c4)nc3c2)cc1 |
| InChI | InChI=1S/C24H21FN2O2/c1-24(2,3)17-9-7-15(8-10-17)22(28)26-19-11-12-21-20(14-19)27-23(29-21)16-5-4-6-18(25)13-16/h4-14H,1-3H3,(H,26,28) |
| InChIKey | SBVGEDOOZIMLJW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |