C20H11Cl2FN2O2 — CID 1338265
N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-4-fluorobenzamide (PubChem CID 1338265) has the molecular formula C20H11Cl2FN2O2 and a molecular weight of 401.22 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-4-fluorobenzamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 1338265 |
| Molecular Formula | C20H11Cl2FN2O2 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H11Cl2FN2O2/c21-15-7-3-12(9-16(15)22)20-25-17-10-14(6-8-18(17)27-20)24-19(26)11-1-4-13(23)5-2-11/h1-10H,(H,24,26) |
| InChIKey | HKGPKKZMGSQMRL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |