C18H10Cl2N2O3 — CID 3442914
N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]furan-2-carboxamide (PubChem CID 3442914) has the molecular formula C18H10Cl2N2O3 and a molecular weight of 373.20 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]furan-2-carboxamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3442914 |
| Molecular Formula | C18H10Cl2N2O3 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1)c1ccco1 |
| InChI | InChI=1S/C18H10Cl2N2O3/c19-12-5-3-10(8-13(12)20)18-22-14-9-11(4-6-15(14)25-18)21-17(23)16-2-1-7-24-16/h1-9H,(H,21,23) |
| InChIKey | FKIIMXXLVMXXQL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |