C18H11ClN2O3 — CID 17296967
N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]furan-2-carboxamide (PubChem CID 17296967) has the molecular formula C18H11ClN2O3 and a molecular weight of 338.75 g/mol. Its IUPAC name is N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17296967 |
| Molecular Formula | C18H11ClN2O3 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nc3cc(Cl)ccc3o2)c1)c1ccco1 |
| InChI | InChI=1S/C18H11ClN2O3/c19-12-6-7-15-14(10-12)21-18(24-15)11-3-1-4-13(9-11)20-17(22)16-5-2-8-23-16/h1-10H,(H,20,22) |
| InChIKey | JTRAJRFMIGDONR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |