C22H17ClN2O2 — CID 1116351
N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3,4-dimethylbenzamide (PubChem CID 1116351) has the molecular formula C22H17ClN2O2 and a molecular weight of 376.84 g/mol. Its IUPAC name is N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3,4-dimethylbenzamide.
| Compound Name | N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 1116351 |
| Molecular Formula | C22H17ClN2O2 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(-c3nc4cc(Cl)ccc4o3)c2)cc1C |
| InChI | InChI=1S/C22H17ClN2O2/c1-13-6-7-15(10-14(13)2)21(26)24-18-5-3-4-16(11-18)22-25-19-12-17(23)8-9-20(19)27-22/h3-12H,1-2H3,(H,24,26) |
| InChIKey | JYUIKTIIFSXWQK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |