C22H18N2O2 — CID 869599
N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]benzamide (PubChem CID 869599) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]benzamide.
| Compound Name | N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 869599 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]benzamide |
| SMILES | Cc1cc2nc(-c3cccc(NC(=O)c4ccccc4)c3)oc2cc1C |
| InChI | InChI=1S/C22H18N2O2/c1-14-11-19-20(12-15(14)2)26-22(24-19)17-9-6-10-18(13-17)23-21(25)16-7-4-3-5-8-16/h3-13H,1-2H3,(H,23,25) |
| InChIKey | YNVHHPFPAOTDLW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |