C21H16N2O2S — CID 7565162
N-[3-(1,3-benzoxazol-2-yl)phenyl]-3-methylsulfanylbenzamide (PubChem CID 7565162) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)phenyl]-3-methylsulfanylbenzamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-3-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 7565162 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-3-methylsulfanylbenzamide |
| SMILES | CSc1cccc(C(=O)Nc2cccc(-c3nc4ccccc4o3)c2)c1 |
| InChI | InChI=1S/C21H16N2O2S/c1-26-17-9-5-6-14(13-17)20(24)22-16-8-4-7-15(12-16)21-23-18-10-2-3-11-19(18)25-21/h2-13H,1H3,(H,22,24) |
| InChIKey | DTIFMAIGSMAIMS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |