C20H13ClN2O2 — CID 3968196
N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-chlorobenzamide (PubChem CID 3968196) has the molecular formula C20H13ClN2O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-chlorobenzamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 3968196 |
| Molecular Formula | C20H13ClN2O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-chlorobenzamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3o2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C20H13ClN2O2/c21-16-9-2-1-8-15(16)19(24)22-14-7-5-6-13(12-14)20-23-17-10-3-4-11-18(17)25-20/h1-12H,(H,22,24) |
| InChIKey | RMPIAPXQCDGMMG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |