C22H18N2O4 — CID 16848752
N-[3-(1,3-benzoxazol-2-yl)phenyl]-2,5-dimethoxybenzamide (PubChem CID 16848752) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)phenyl]-2,5-dimethoxybenzamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 16848752 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2cccc(-c3nc4ccccc4o3)c2)c1 |
| InChI | InChI=1S/C22H18N2O4/c1-26-16-10-11-19(27-2)17(13-16)21(25)23-15-7-5-6-14(12-15)22-24-18-8-3-4-9-20(18)28-22/h3-13H,1-2H3,(H,23,25) |
| InChIKey | VBFMUHMHSJOONN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |