C21H13Cl2N3O2S — CID 2183818
N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,4-dichlorobenzamide (PubChem CID 2183818) has the molecular formula C21H13Cl2N3O2S and a molecular weight of 442.33 g/mol. Its IUPAC name is N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,4-dichlorobenzamide.
| Compound Name | N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 2183818 |
| Molecular Formula | C21H13Cl2N3O2S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2,4-dichlorobenzamide |
| SMILES | O=C(NC(=S)Nc1cccc(-c2nc3ccccc3o2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H13Cl2N3O2S/c22-13-8-9-15(16(23)11-13)19(27)26-21(29)24-14-5-3-4-12(10-14)20-25-17-6-1-2-7-18(17)28-20/h1-11H,(H2,24,26,27,29) |
| InChIKey | GPIAEMYBQYLQBI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|