C25H14Cl3N3O2S — CID 17315164
5-chloro-N-[[3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 17315164) has the molecular formula C25H14Cl3N3O2S and a molecular weight of 526.83 g/mol. Its IUPAC name is 5-chloro-N-[[3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-[[3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 17315164 |
| Molecular Formula | C25H14Cl3N3O2S |
| Molecular Weight | 526.83 g/mol |
| Exact Mass | 524.99 |
| IUPAC Name | 5-chloro-N-[[3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(-c2nc3cc(Cl)cc(Cl)c3o2)c1)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C25H14Cl3N3O2S/c26-14-11-20(28)22-21(12-14)30-24(33-22)13-4-1-5-15(10-13)29-25(34)31-23(32)18-8-2-7-17-16(18)6-3-9-19(17)27/h1-12H,(H2,29,31,32,34) |
| InChIKey | ZWHCDZHCYSGFPW-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.83 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|