C27H20ClN3O2S — CID 17113984
5-chloro-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 17113984) has the molecular formula C27H20ClN3O2S and a molecular weight of 486.00 g/mol. Its IUPAC name is 5-chloro-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 17113984 |
| Molecular Formula | C27H20ClN3O2S |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 5-chloro-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | Cc1cc(C)c2oc(-c3cccc(NC(=S)NC(=O)c4cccc5c(Cl)cccc45)c3)nc2c1 |
| InChI | InChI=1S/C27H20ClN3O2S/c1-15-12-16(2)24-23(13-15)30-26(33-24)17-6-3-7-18(14-17)29-27(34)31-25(32)21-10-4-9-20-19(21)8-5-11-22(20)28/h3-14H,1-2H3,(H2,29,31,32,34) |
| InChIKey | CAVFJAWBRRRHLQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|