C24H19ClN4O4S — CID 5063803
N-[[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide (PubChem CID 5063803) has the molecular formula C24H19ClN4O4S and a molecular weight of 494.96 g/mol. Its IUPAC name is N-[[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 5063803 |
| Molecular Formula | C24H19ClN4O4S |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-[[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1cc(C)c2oc(-c3cc(NC(=S)NC(=O)c4cccc([N+](=O)[O-])c4C)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C24H19ClN4O4S/c1-12-9-13(2)21-19(10-12)27-23(33-21)17-11-15(7-8-18(17)25)26-24(34)28-22(30)16-5-4-6-20(14(16)3)29(31)32/h4-11H,1-3H3,(H2,26,28,30,34) |
| InChIKey | FYVWFXHWOMSHFK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|