C22H23Cl2N3O2S — CID 4510751
4-chloro-N-[[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-methylpentanamide (PubChem CID 4510751) has the molecular formula C22H23Cl2N3O2S and a molecular weight of 464.42 g/mol. Its IUPAC name is 4-chloro-N-[[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-methylpentanamide.
| Compound Name | 4-chloro-N-[[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 4510751 |
| Molecular Formula | C22H23Cl2N3O2S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 4-chloro-N-[[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-methylpentanamide |
| SMILES | Cc1cc(C)c2oc(-c3cc(NC(=S)NC(=O)CCC(C)(C)Cl)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C22H23Cl2N3O2S/c1-12-9-13(2)19-17(10-12)26-20(29-19)15-11-14(5-6-16(15)23)25-21(30)27-18(28)7-8-22(3,4)24/h5-6,9-11H,7-8H2,1-4H3,(H2,25,27,28,30) |
| InChIKey | DQMCZPYRMGBBGT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|