C20H20ClN3O2S — CID 1048098
N-[[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-methylbutanamide (PubChem CID 1048098) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is N-[[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 1048098 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-methylbutanamide |
| SMILES | Cc1ccc2nc(-c3cc(NC(=S)NC(=O)CC(C)C)ccc3Cl)oc2c1 |
| InChI | InChI=1S/C20H20ClN3O2S/c1-11(2)8-18(25)24-20(27)22-13-5-6-15(21)14(10-13)19-23-16-7-4-12(3)9-17(16)26-19/h4-7,9-11H,8H2,1-3H3,(H2,22,24,25,27) |
| InChIKey | UFPMCSVVUPRERF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|