C24H17Cl2N3O3S — CID 135775829
(E)-3-(2,4-dichlorophenyl)-N-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 135775829) has the molecular formula C24H17Cl2N3O3S and a molecular weight of 498.39 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 135775829 |
| Molecular Formula | C24H17Cl2N3O3S |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc2nc(-c3cc(NC(=S)NC(=O)/C=C/c4ccc(Cl)cc4Cl)ccc3O)oc2c1 |
| InChI | InChI=1S/C24H17Cl2N3O3S/c1-13-2-7-19-21(10-13)32-23(28-19)17-12-16(6-8-20(17)30)27-24(33)29-22(31)9-4-14-3-5-15(25)11-18(14)26/h2-12,30H,1H3,(H2,27,29,31,33)/b9-4+ |
| InChIKey | VZVUKZLKDKXGMI-RUDMXATFSA-N |
| XLogP | 6.34 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|