C25H19Cl2N3O2S — CID 17115140
(E)-3-(2,4-dichlorophenyl)-N-[[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]prop-2-enamide (PubChem CID 17115140) has the molecular formula C25H19Cl2N3O2S and a molecular weight of 496.42 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17115140 |
| Molecular Formula | C25H19Cl2N3O2S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1cc(C)cc(-c2nc3cc(NC(=S)NC(=O)/C=C/c4ccc(Cl)cc4Cl)ccc3o2)c1 |
| InChI | InChI=1S/C25H19Cl2N3O2S/c1-14-9-15(2)11-17(10-14)24-29-21-13-19(6-7-22(21)32-24)28-25(33)30-23(31)8-4-16-3-5-18(26)12-20(16)27/h3-13H,1-2H3,(H2,28,30,31,33)/b8-4+ |
| InChIKey | JVTAKPFHOLTIRO-XBXARRHUSA-N |
| XLogP | 6.94 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|