C23H17Cl2N3O2S — CID 17104608
3,4-dichloro-N-[[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide (PubChem CID 17104608) has the molecular formula C23H17Cl2N3O2S and a molecular weight of 470.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17104608 |
| Molecular Formula | C23H17Cl2N3O2S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 3,4-dichloro-N-[[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
| SMILES | Cc1cc(C)cc(-c2nc3cc(NC(=S)NC(=O)c4ccc(Cl)c(Cl)c4)ccc3o2)c1 |
| InChI | InChI=1S/C23H17Cl2N3O2S/c1-12-7-13(2)9-15(8-12)22-27-19-11-16(4-6-20(19)30-22)26-23(31)28-21(29)14-3-5-17(24)18(25)10-14/h3-11H,1-2H3,(H2,26,28,29,31) |
| InChIKey | CIYOQVHYRGPJJL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|