C23H15Cl3N2O2 — CID 5010027
N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 5010027) has the molecular formula C23H15Cl3N2O2 and a molecular weight of 457.74 g/mol. Its IUPAC name is N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5010027 |
| Molecular Formula | C23H15Cl3N2O2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | Cc1ccc2oc(-c3ccc(Cl)c(NC(=O)C=Cc4ccc(Cl)cc4Cl)c3)nc2c1 |
| InChI | InChI=1S/C23H15Cl3N2O2/c1-13-2-8-21-20(10-13)28-23(30-21)15-4-7-17(25)19(11-15)27-22(29)9-5-14-3-6-16(24)12-18(14)26/h2-12H,1H3,(H,27,29) |
| InChIKey | OSXDFGYIYCZWMI-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|