C23H15Cl3N2O3 — CID 3959456
N-[5-(1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 3959456) has the molecular formula C23H15Cl3N2O3 and a molecular weight of 473.74 g/mol. Its IUPAC name is N-[5-(1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[5-(1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3959456 |
| Molecular Formula | C23H15Cl3N2O3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | N-[5-(1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1cc(-c2nc3ccccc3o2)ccc1Cl |
| InChI | InChI=1S/C23H15Cl3N2O3/c1-30-22-13(10-15(24)12-17(22)26)7-9-21(29)27-19-11-14(6-8-16(19)25)23-28-18-4-2-3-5-20(18)31-23/h2-12H,1H3,(H,27,29) |
| InChIKey | DZDFZUOKLYJNGG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|